This compound is a boronic acid derivative of carbazole, featuring two phenyl substituents. It is primarily used as an intermediate in the synthesis of organic materials, particularly in the development of optoelectronic devices.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1133058-06-6
(4-(9-Phenyl-9H-carbazol-3-yl)phenyl)boronic acid
Electronic material precursor
9-phenyl-9H-carbazole-3-boronic acid
organic synthesis reagent
4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]-2,3,5,6-tetradeuteriobenzoic acid
deuterated research reference compound
(+/-)-Carvedilol-d4
deuterated research compound
1-bromo-2-(3-phenylphenyl)benzene
research compound
4,4'-Dimethyl-2,2'-bipyridine
diimine ligand for metal complexes
3-(4-Bromophenyl)-9-phenylcarbazole
OLED material intermediate
(6,9-diphenylcarbazol-3-yl)boronic acid
AIDQRXUWQFRMAQ-UHFFFAOYSA-N
B(C1=CC2=C(C=C1)N(C3=C2C=C(C=C3)C4=CC=CC=C4)C5=CC=CC=C5)(O)O
—