Vitamin K1-d7 is a deuterated reference standard of vitamin K1, used primarily in analytical and research settings for quantification and tracing studies. Its structure incorporates seven deuterium atoms at specific positions, providing a stable isotopic label for mass spectrometry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1233937-39-7
1-(5-Bromo-4-chlorothiophen-2-yl)ethan-1-one
research compound
XMD 8-92
protein kinase inhibitor research tool
2-Chloroethyl trityl ether
research compound
Pentamethylcyclopentadienyliridium dichloride
organometallic synthesis reagent
2-Methyl-3-(3,7,11,15-tetramethyl-2-hexadecen-1-yl)-1,4-naphthoquinone
Vitamin K1 analog
필로퀴논
Vitamin K1 pharmaceutical ingredient
Menaquinone 7-d7
stable isotope labeled research compound
1,4-NAPHTHOQUINONE
chemical intermediate for dyes and pharmaceuticals
5,6,7,8-tetradeuterio-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]-3-(trideuteriomethyl)naphthalene-1,4-dione
MBWXNTAXLNYFJB-VKXGTQFMSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=O)C(=C(C2=O)C([2H])([2H])[2H])C/C=C(\C)/CCCC(C)CCCC(C)CCCC(C)C)[2H])[2H]