Cytidine triphosphate (CTP) is a nucleotide triphosphate consisting of a cytosine base, a ribose sugar, and three phosphate groups. It serves as a fundamental building block for RNA synthesis and plays a key role in cellular energy metabolism and lipid biosynthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Cytidine triphosphate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Cytidine triphosphate
Nucleotide intermediate for RNA synthesis
Cytidine-5'-O-(1-thiotriphosphate)
nucleotide research reagent
Cytidine-5'-O-(1-thiotriphosphate)
biochemical research reagent
143028-98-2 (free acid)
nucleotide research reagent
Thymidine 5'-triphosphate sodium salt
nucleotide triphosphate research reagent
5-Methoxyuridine 5'-triphosphate
nucleotide triphosphate research reagent
Inosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, trisodium salt
nucleotide triphosphate research reagent
Menaquinone 7-d7
stable isotope labeled research compound
[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
PCDQPRRSZKQHHS-XVFCMESISA-N
C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O
Cytidine triphosphate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.