4-Bromophenylalanine hydrochloride is a research reagent consisting of the hydrochloride salt of 4-bromo-L-phenylalanine, an amino acid derivative featuring a bromine substituent on the aromatic ring. It is primarily utilized as a building block or intermediate in laboratory and pharmaceutical research settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 122839-59-2
4-BROMO-L-PHENYLALANINE
Peptide building block pharmaceutical intermediate
(R)-3-((tert-Butoxycarbonyl)amino)-3-(4-ethylphenyl)propanoic acid
research compound for peptide synthesis
(R)-2-(1-Aminoethyl)-4-fluorophenol
research compound
6-Aminocaproic acid-d6
deuterated analytical research standard
Edaravone D5
Deuterated research compound
(R)-2-amino-3-(4-bromophenyl)propionic acid
Pharmaceutical intermediate
(2S)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride
GRWMPXZZFAPLFZ-QRPNPIFTSA-N
C1=CC(=CC=C1C[C@@H](C(=O)O)N)Br.Cl