Edaravone D5 is a deuterated form of the neuroprotective compound edaravone, used as a research reagent. Its primary significance lies in its role as an isotopically labeled analog for studying neuroprotection and oxidative stress pathways in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Edaravone D5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3,5-dibromopyridine-d3
Deuterated research compound
Cyclobutanone-2,2,4,4-d4
Deuterated research compound
4-Methoxyaniline--d4
Deuterated research compound
2-Aminohexane-d6
Deuterated research compound
Pioglitazone impurity 30
Pioglitazone impurity reference standard
(R)-N-[1-(5,6,7,8-Tetrahydronaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]-1-propylamine
research reagent
(R)-1-(Naphthalen-1-yl)-N-(3-(trifluoromethyl)benzyl)ethanamine hydrochloride
Certified reference standard for impurity analysis
(2S,4R)-4-(tert-butoxy)-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}pyrrolidine-2-carboxylic acid
Fmoc-protected amino acid building block
5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-4H-pyrazol-3-one
QELUYTUMUWHWMC-VIQYUKPQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N2C(=O)CC(=N2)C)[2H])[2H]
Edaravone D5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.