Seco-DUBA is a chemical compound characterized by the presence of multiple amide, aromatic, and heterocyclic groups, along with a halogen atom, giving it a specific ring-containing and moderately polar structure. It is primarily recognized as a research reagent used in the context of antibody-drug conjugate development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Seco-DUBA 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
MAC glucuronide phenol-linked SN-38
antibody-drug conjugate payload
4-pyridin-2-yloxycyclohexane-1-carbohydrazide
research compound
Cimaterol D7
deuterated analytical reference standard
4-bromophenylalanine hydrochloride
research compound
(R)-3-((tert-Butoxycarbonyl)amino)-3-(4-ethylphenyl)propanoic acid
research compound for peptide synthesis
N-[2-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]imidazo[1,2-a]pyridin-6-yl]-4-hydroxybenzamide
VQAFBYLFRCCWNB-GOSISDBHSA-N
CC1=C2C(=CC=C1)C(=CC3=C2[C@@H](CN3C(=O)C4=CN5C=C(C=CC5=N4)NC(=O)C6=CC=C(C=C6)O)CCl)O
Seco-DUBA 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.