This compound is an Fmoc-protected, alpha-methylated derivative of 2,6-difluorophenylalanine, commonly used as a building block in solid-phase peptide synthesis. Its structure incorporates a fluorenylmethoxycarbonyl (Fmoc) group for temporary amine protection, enabling the stepwise assembly of peptides containing a sterically hindered, fluorinated amino acid residue.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
FMoc-alpha-Me-D-Phe(2-F)-OH
Fmoc-protected amino acid for peptide synthesis
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-fluorophenyl)-2-methylpropanoic acid
Research reagent for peptide synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid
Fmoc-protected amino acid for peptide synthesis
N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-glutamine
Fmoc-protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
N-(9-Fluorenylmethoxycarbonyl)-D-proline
Fmoc-protected amino acid for peptide synthesis
2'-guanylic acid
ribonuclease T1 inhibitor
(4-(benzyloxy)-3,5-difluorophenyl)methanol
research compound
(2S)-3-(2,6-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid
MRIVYBRWULFPFJ-VWLOTQADSA-N
C[C@](CC1=C(C=CC=C1F)F)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.