Guanosine 2'-monophosphate is a purine ribonucleoside 2'-monophosphate with guanine as the nucleobase. It is recognized as an inhibitor of ribonuclease T1 (EC 3.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2'-guanylic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2'-O-Methylguanosine
Pharmaceutical intermediate for modified RNA synthesis
2'-O-(2-METHOXYETHYL)GUANOSINE
Pharmaceutical intermediate for RNA synthesis
Guanosine
purine nucleoside research reagent
(4-(benzyloxy)-3,5-difluorophenyl)methanol
research compound
Methyl 5-Bromo-2-methoxynicotinate
research compound
Cyclooctene;iridium;dichloride
organoiridium catalyst precursor
(2S)-2-((2-(2-(2-(2-(2-(2-(2-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)ethylamino)-2-oxoethoxy)acetyl)amino)-N-(4-(hydroxymethyl)phenyl)-6-(((4-methoxyphenyl)-diphenylmethyl)amino)hexanamide
PEGylated bifunctional linker reagent
[(2R,3R,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate
WTIFIAZWCCBCGE-UUOKFMHZSA-N
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)OP(=O)(O)O)N=C(NC2=O)N
2'-guanylic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.