2,4-Dibromophenol-3,5,6-d3 is a deuterium-labeled analytical standard used primarily in research and testing. The compound features an aromatic ring with two bromine atoms and three deuterium substitutions, providing a stable isotopic label for quantitative analysis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,4-dibromophenol-3,5,6-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,2',3,4,5,5'-hexachlorobiphenyl-3',4',6'-d3
isotope-labeled analytical standard
4,4'-DICHLOROBENZOPHENONE-D8
Deuterated analytical reference standard
Monoethyl Phthalate-d4
isotopically labeled research reference standard
9-Amino-1,2,3,4-tetrahydroacridin-1-ol-d3
Deuterated research compound
Pyrazine-2,5-dicarboxylic acid
research compound
2,4-DIBROMOPHENOL
Brominated flame retardant
2,4-dibromo-3,5,6-trideuteriophenol
FAXWFCTVSHEODL-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1O)Br)[2H])Br)[2H]
2,4-dibromophenol-3,5,6-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.