3,5-Dichlorobenzoic-d3 Acid is a deuterated research reagent, specifically the isotopically labeled form of 3,5-dichlorobenzoic acid where three hydrogen atoms are replaced with deuterium. This compound is used in analytical and synthetic chemistry for tracing and mechanistic studies, leveraging its stable isotope labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,5-Dichlorobenzoic-d3 Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-OHPropranolol-d7 HCl
Deuterium-labeled research compound
2,2-Dimethylbutanoic acid-d11
deuterated research reagent
2-[Bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetamide
deuterated reference standard
1,5-PENTANE-D10-DIOL
Deuterated research reagent
3,5-DICHLOROBENZOIC ACID
herbicide and metabolite
3,5-dichloro-2,4,6-trideuteriobenzoic acid
CXKCZFDUOYMOOP-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1Cl)[2H])Cl)[2H])C(=O)O
3,5-Dichlorobenzoic-d3 Acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.