3,5-Dichlorobenzoic-d3 Acid is a deuterated research reagent, specifically the isotopically labeled form of 3,5-dichlorobenzoic acid where three hydrogen atoms are replaced with deuterium. This compound is used in analytical and synthetic chemistry for tracing and mechanistic studies, leveraging its stable isotope labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1219803-99-2
4-OHPropranolol-d7 HCl
Deuterium-labeled research compound
2,2-Dimethylbutanoic acid-d11
deuterated research reagent
2-[Bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetamide
deuterated reference standard
1,5-PENTANE-D10-DIOL
Deuterated research reagent
3,5-DICHLOROBENZOIC ACID
herbicide and metabolite
3,5-dichloro-2,4,6-trideuteriobenzoic acid
CXKCZFDUOYMOOP-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1Cl)[2H])Cl)[2H])C(=O)O