4-OHPropranolol-d7 HCl is a deuterium-labeled research compound, specifically the hydrochloride salt of heptadeuterated 4-hydroxypropranolol. It is primarily used as a stable isotope-labeled internal standard for analytical method development and quantification in mass spectrometry-based studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-OHPropranolol-d7 HCl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,6-DICHLOROANILINE-3,4,5-D3
Deuterium-labeled research compound
Hydroxychloroquine-d4 Sulfate
Deuterium-labeled research compound
2,2-Dimethylbutanoic acid-d11
deuterated research reagent
2-[Bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfinyl]acetamide
deuterated reference standard
1,5-PENTANE-D10-DIOL
Deuterated research reagent
1,5-dinitronaphthalene-d6
deuterated reference standard
4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]naphthalen-1-ol;hydrochloride
ROUJENUXWIFONU-BGKGEVRXSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C2=CC=CC=C21)O)O.Cl
4-OHPropranolol-d7 HCl 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.