2,6-Dibromophenol-3,4,5-d3 is a deuterated research compound in which three hydrogen atoms on the phenol ring are replaced with deuterium. This isotopic labeling makes it useful as a reference standard or tracer in analytical and mechanistic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,6-dibromophenol-3,4,5-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Methylcatechol-d8
isotope-labeled research compound
3,4-Dichloroaniline-d2
deuterated research reference standard
1,3-diethylbenzene-d14
deuterated reference standard for analytical chemistry
4-Aminopiperidine-3,3,4,5,5-d5
deuterated research compound
2,6-dibromo-3,4,5-trideuteriophenol
SSIZLKDLDKIHEV-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1[2H])Br)O)Br)[2H]
2,6-dibromophenol-3,4,5-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.