2,5-difluorobenzoic-d3 acid is a deuterium-labeled research reagent, where three hydrogen atoms on the aromatic ring are replaced with deuterium. As a labeled analogue of 2,5-difluorobenzoic acid, it is used in analytical and tracer studies to investigate chemical pathways and reaction mechanisms.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1219798-63-6
2,3,6-trichloroanisole-d3 (methoxy-d3)
deuterated analytical reference standard
N-PENTYL 4-HYDROXYBENZOATE-2,3,5,6-D4
deuterated research standard
3,4-difluorobenzoic-d3 acid
research compound
4-Methoxyphenyl-2,3,5,6-d4-acetonitrile
deuterated research compound
2,5-Difluorobenzoic acid
research compound
Sodium 2,5-difluorobenzoate
n.a
2,4,5-trideuterio-3,6-difluorobenzoic acid
LBQMIAVIGLLBGW-CBYSEHNBSA-N
[2H]C1=C(C(=C(C(=C1F)[2H])C(=O)O)F)[2H]