This compound is a deuterated research standard, specifically a pentyl ester of 4-hydroxybenzoic acid where the four aromatic hydrogen atoms are replaced by deuterium. It is primarily used as a labeled reference compound in analytical chemistry and mass spectrometry for quantification or tracing studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1219798-66-9
N-butyl 4-hydroxybenzoate-2,3,5,6-d4
cosmetic preservative
N-propyl 4-hydroxybenzoate-2,3,5,6-d4
Preservative in cosmetics and personal care
3,4-difluorobenzoic-d3 acid
research compound
4-Methoxyphenyl-2,3,5,6-d4-acetonitrile
deuterated research compound
1,2-Phenylenediamine-d8
deuterium-labeled research compound
2,4-Difluorotoluene-3,5,6-d3
deuterium-labeled research compound
pentyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate
ZNSSPLQZSUWFJT-KDWZCNHSSA-N
[2H]C1=C(C(=C(C(=C1C(=O)OCCCCC)[2H])[2H])O)[2H]