Nitrofurazone-13C,15N2 is an isotopically labeled form of the antimicrobial compound nitrofurazone, where specific carbon and nitrogen atoms are replaced with their stable isotopes (13C and 15N). It is primarily used as a research reagent for tracing and analytical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Nitrofurazone-13C,15N2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Allantoin-13C2,15N4
isotopically labeled research compound
4,6-Dihydroxypyrazolo[3,4-d]pyrimidine-13C,15N2
isotopically labeled research compound
2,5-Dichlorobiphenyl-2',3',4',5',6'-d5
isotopically labeled research compound
Acamprosate-d12 Calcium (dipropyl-d12)
isotopically labeled research compound
4-(4-Bromo-3-(1,3-dioxolan-2-yl)phenoxy)benzonitrile
Research reagent
Aflatoxin G1-d3
deuterated analytical reference standard
(9H-Fluoren-9-yl)methyl (S)-pyrrolidin-3-ylcarbamate
research reagent
Tert-butyl N-[(3R)-piperidin-3-yl]carbamate hydrochloride
research compound
[(E)-(5-nitrofuran-2-yl)methylideneamino](13C)urea
IAIWVQXQOWNYOU-LTGGZAIESA-N
C1=C(OC(=C1)[N+](=O)[O-])/C=[15N]/[15NH][13C](=O)N
Nitrofurazone-13C,15N2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.