This compound is a chiral amino alcohol derivative bearing a 4-chlorophenyl substituent, typically supplied as a research reagent. Its structure includes an aromatic ring, an alcohol group, and an amine group, contributing to its use in laboratory investigations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1213362-28-7
Palladium hydroxide
Catalyst for hydrogenolysis reactions
(7-Bromo-9,9-dimethyl-9H-fluoren-2-yl)boronic Acid (contains varying amounts of Anhydride)
organic synthesis intermediate
2'-Hydroxychalcone
research compound
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine
Boron reagent for cross-coupling
(3s)-3-amino-3-(4-chlorophenyl)propan-1-ol
research compound
(3R)-3-amino-3-(4-chlorophenyl)propan-1-ol
JGNACDMQJLVKIU-SECBINFHSA-N
C1=CC(=CC=C1[C@@H](CCO)N)Cl
—