This compound is a research reagent that serves as a boron-based coupling agent, commonly utilized in cross-coupling reactions within laboratory settings. Its structure features a boron-containing heterocycle with aromatic rings, contributing to its utility in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1214264-88-6
Methyl 5-bromo-3-(trifluoromethyl)pyridine-2-carboxylate
Research chemical intermediate
Methyl 5-bromo-6-methoxypicolinate
research compound
6-Bromo-2-fluoropyridine-3-carboxylic acid
research compound
Methyl 5-chloro-3-(trifluoromethyl)picolinate
heterocyclic research compound
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene
WWUSOISWGYNXKX-UHFFFAOYSA-N
B1(NC2=CC=CC3=C2C(=CC=C3)N1)B4OC(C(O4)(C)C)(C)C