This compound is a chemical compound used primarily as a research reagent. Its structure features a benzodioxole ring with two fluorine atoms, an aromatic ring, and hydroxyl and ether functional groups, giving it moderate polarity and low molecular weight.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,2-difluorobenzo[d][1,3]dioxol-5-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Diacetic Aceclofenac
Impurity reference standard
3-CHLOROTOLUENE-D7
Deuterated analytical reference standard
P-21 nootropic peptide
nootropic peptide research compound
Epicatechin gallate
polyphenol with enzyme inhibition activity
2,2-difluoro-1,3-benzodioxol-5-ol
GEHVTOIGEVNIEQ-UHFFFAOYSA-N
C1=CC2=C(C=C1O)OC(O2)(F)F
2,2-difluorobenzo[d][1,3]dioxol-5-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.