Diacetic Aceclofenac is a chemical compound that serves as an impurity reference standard for aceclofenac. Structurally, it is a polar, multiple ester-containing derivative featuring two aromatic rings and a halogenated aniline moiety.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1216495-92-9
Acetic Aceclofenac
active pharmaceutical ingredient
아세클로페낙
Active pharmaceutical ingredient
(2-oxo-2-phenylmethoxyethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate
pharmaceutical impurity reference standard
Aceclofenac Ethyl Ester
Pharmaceutical intermediate for aceclofenac production
4-Methylbenzene-1-sulfonic acid--2-(2-methoxyethoxy)ethan-1-ol (1/1)
Impurity reference standard
5-Chloro-6-methyl-1,2,3-oxathiazin-4(3H)-one 2,2-dioxide
Impurity reference standard
3-CHLOROTOLUENE-D7
Deuterated analytical reference standard
P-21 nootropic peptide
nootropic peptide research compound
2-[2-[2-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyacetyl]oxyacetyl]oxyacetic acid
ZCCRLKICIDWHKV-UHFFFAOYSA-N
C1=CC=C(C(=C1)CC(=O)OCC(=O)OCC(=O)OCC(=O)O)NC2=C(C=CC=C2Cl)Cl