Ethyl all cis-7,10,13,16,19-Docosapentaenoate is a polyunsaturated fatty acid ester, specifically the ethyl ester of all-cis-7,10,13,16,19-docosapentaenoic acid. It is primarily used as a research compound, with structural features indicating high flexibility due to multiple double bonds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Ethyl all cis-7,10,13,16,19-Docosapentaenoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ethyl icosapentate
omega-3 fatty acid ethyl ester
Ethyl oleate
Flavoring agent for animal feed
2-Cyano-3-(trifluoromethyl)phenylboronic acid
Boronic acid research reagent
2-AMINOISOINDOLINE-1,3-DIONE HYDROCHLORIDE
research compound
2-(2,4-Dimethylphenylamino)isoindoline-1,3-dione
research compound
9-Bromo-11,11-dimethyl-11H-benzo[a]fluorene
research compound
ethyl (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate
VCSQUSNNIFZJAP-AAQCHOMXSA-N
CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OCC
Ethyl all cis-7,10,13,16,19-Docosapentaenoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.