Ethyl oleate is an ester compound used primarily as a flavoring agent in animal feed. It also serves as a solvent or co-solvent in certain pesticide products.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 111-62-6
Ethyl all cis-7,10,13,16,19-Docosapentaenoate
research compound
Enramycin
Feed additive for poultry and swine
Calcium gluconolactate
calcium supplement
(+-)-Pantothenic acid
Vitamin B5 dietary supplement
N-Acetyl-DL-methionine
nutritional supplement and food additive
ethyl (Z)-octadec-9-enoate
LVGKNOAMLMIIKO-QXMHVHEDSA-N
CCCCCCCC/C=C\CCCCCCCC(=O)OCC