This compound is a polycyclic aromatic diol featuring two bromine substituents and two 9,9-dimethylfluoren-2-yl groups attached to an anthracene-9,10-diol core. Its structure includes multiple aromatic rings and alcohol functional groups, making it a specialized laboratory reagent for organic synthesis and materials research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1154751-56-0
1-Benzyl-N-phenylpiperidin-4-amine
Research reagent for pharmacological studies
N-Carbobenzoxy-L-glutamic acid
Research compound for peptide synthesis
(1R,2S)-2-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride
pharmaceutical research compound
(1-aminocyclopropyl)methanol hydrochloride
research compound
2,6-dibromo-9,10-bis(9,9-dimethylfluoren-2-yl)anthracene-9,10-diol
DOVVBLFNAFZXLO-UHFFFAOYSA-N
CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C4(C5=C(C=C(C=C5)Br)C(C6=C4C=C(C=C6)Br)(C7=CC8=C(C=C7)C9=CC=CC=C9C8(C)C)O)O)C
—