1-Benzyl-N-phenylpiperidin-4-amine is a chemical compound used primarily as a research reagent in pharmacological studies. Its structure features a piperidine ring with benzyl and phenyl substituents, contributing to its aromatic and amine characteristics.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-Benzyl-N-phenylpiperidin-4-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-Carbobenzoxy-L-glutamic acid
Research compound for peptide synthesis
(1R,2S)-2-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride
pharmaceutical research compound
(1-aminocyclopropyl)methanol hydrochloride
research compound
2-bromo-5-fluoro-4-(trifluoromethyl)pyridine
Research reagent for chemical synthesis
Benzylfentanyl
research compound
1-Benzyl-N-phenylpiperidin-4-amine(CAS 1155-56-2)의 국제 HS 코드는 2933.39입니다.
2933.39
2933 39 99
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1-benzyl-N-phenylpiperidin-4-amine
FSXGJIFBTBJMHV-UHFFFAOYSA-N
C1CN(CCC1NC2=CC=CC=C2)CC3=CC=CC=C3
1-Benzyl-N-phenylpiperidin-4-amine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.