Tetrabenzyl-voglibose is a polybenzylated derivative of voglibose, used as a pharmaceutical intermediate in the synthesis of the alpha-glucosidase inhibitor voglibose. It contains multiple ether and alcohol functional groups and is characterized by a complex stereochemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 115250-39-0
2-(4-aminophenyl)-2-methylpropanenitrile
pharmaceutical intermediate
Glycidyl 3-nitrobenzenesulfonate
Pharmaceutical intermediate
Benzenesulfonic acid, 3-nitro-, (2R)-2-oxiranylmethyl ester
Pharmaceutical intermediate for synthesis
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(trifluoromethylsulfonyloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
pharmaceutical intermediate
2-[[(1S,2S,3R,4S,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]amino]propane-1,3-diol
DYSHUNINHUTCLX-ILOBPARPSA-N
C1[C@@H]([C@@H]([C@H]([C@@H]([C@]1(COCC2=CC=CC=C2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)NC(CO)CO