Phenylalanyl-glycyl-histidyl-statyl-alanyl-phenylalanine methyl ester is a peptide-based research compound with a complex, flexible structure containing multiple amide bonds, aromatic rings, and polar functional groups. It is used primarily as a laboratory reagent for scientific investigation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Hexapeptide 5
cosmetic peptide for wrinkle improvement
1-Bromo-2-(bromomethyl)-4-fluorobenzene
research compound
Trideuteriomethylbenzene
deuterated internal standard
4-BROMOTOLUENE-2,3,5,6-D4
deuterated research standard
5-CHLORO-2-HYDROXY-4-IODOPYRIDINE
Research compound for synthesis
methyl (2S)-2-[[(2S)-2-[[(3S,4S)-4-[[(2S)-2-[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxy-6-methylheptanoyl]amino]propanoyl]amino]-3-phenylpropanoate
OHFBCDFWQFKELV-KNIQQNQGSA-N
C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)OC)NC(=O)C[C@@H]([C@H](CC(C)C)NC(=O)[C@H](CC2=CN=CN2)NC(=O)CNC(=O)[C@H](CC3=CC=CC=C3)N)O
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.