This compound is a chiral pharmaceutical intermediate used in the synthesis of Exatecan. It features a complex fused-ring structure with multiple functional groups, including an alcohol, ester, and aromatic ring.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 110351-94-5
((3as,5r,6s,6as)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)(morpholino)methanone
pharmaceutical intermediate
(2-chloro-5-iodophenyl)(4-ethoxyphenyl)methanone
Pharmaceutical intermediate
110428-42-7
steroidal pharmaceutical intermediate
N-Methylparoxetine
Pharmaceutical intermediate for paroxetine
(4S)-4-ethyl-4-hydroxy-7,8-dihydro-1H-pyrano[3,4-f]indolizine-3,6,10-trione
IGKWOGMVAOYVSJ-ZDUSSCGKSA-N
CC[C@@]1(C2=C(COC1=O)C(=O)N3CCC(=O)C3=C2)O