This compound is a steroidal pharmaceutical intermediate used in the synthesis of corticosteroid derivatives. Its structure features multiple rings, including acetal and ether functional groups, which contribute to its role as a building block in steroid chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
110428-42-7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Delta-5(10)-Norethindrone Acetate
steroidal pharmaceutical intermediate
N-Methylparoxetine
Pharmaceutical intermediate for paroxetine
2'-Deoxy-N6-phenoxyacetyladenosine
pharmaceutical intermediate
Ethyl 5-(acetyloxy)-6-bromo-2-(bromomethyl)-1-methyl-1H-indole-3-carboxylate
pharmaceutical intermediate
(R)-1-(4-chlorophenyl)-1-propanol
pharmaceutical intermediate
ZVUKJCRDHBHOOD-VQSCDDITSA-N
C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@H]3[C@H](C[C@@]2([C@@]15C6(COCO6)OCO5)C)O)C
110428-42-7 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.