5'-Tosyl-2'-deoxy Guanosine is a modified nucleoside derivative. It is a research compound featuring a tosyl protecting group at the 5' position and a guanine base, used primarily in synthetic organic chemistry and pharmaceutical research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 109954-64-5
Trihydro(pyridine)boron
Reducing agent and reagent
Benzyltriphenylphosphonium chloride
phase transfer catalyst
3-bromo-1,2,4-thiadiazol-5-amine
research compound
(3aS,5R,6S,6aS)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxole-5-carboxylic acid
Research chemical for synthetic studies
[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate
QZERCZKEESOISM-JHJVBQTASA-N
CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2[C@@H](C[C@@H](O2)N3C=NC4=C3N=C(NC4=O)N)O