Benzyltriphenylphosphonium chloride is a quaternary phosphonium salt commonly employed as a phase transfer catalyst in organic synthesis. It facilitates the transfer of reactants between immiscible liquid phases, enabling reactions under mild conditions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1100-88-5
Tetrabutylphosphonium bromide
phase transfer catalyst
Tbaf(tbuoh)4
phase transfer catalyst
Phosphonium, butyltriphenyl-, chloride
phase transfer catalyst
Tetrabutylammonium hydrogen sulfate
phase transfer catalyst
3-bromo-1,2,4-thiadiazol-5-amine
research compound
(3aS,5R,6S,6aS)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxole-5-carboxylic acid
Research chemical for synthetic studies
(4-chloro-3-(4-ethoxybenzyl)phenyl)((3as,5r,6s,6as)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanone
research compound
1-Bromo-2-chloro-4-fluorobenzene
research compound
benzyl(triphenyl)phosphanium chloride
USFRYJRPHFMVBZ-UHFFFAOYSA-M
C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]