Phenylacetic-2,2-d2 acid is a deuterated form of phenylacetic acid, specifically labeled with two deuterium atoms at the alpha position. It is primarily used as a research standard in analytical chemistry and metabolic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1076-07-9
4-Hydroxycoumarin
Chemical research reagent
Perdeuterobenzene
NMR solvent and reference standard
Methyl 6-bromo-1H-indole-4-carboxylate
research compound
Amyloid beta 1-42
research compound for Alzheimer's disease
Phenylacetic-d7 acid
deuterated standard for analytical chemistry
PHENYLACETIC ACID
Perfume and flavoring agent
2,2-dideuterio-2-phenylacetic acid
WLJVXDMOQOGPHL-NCYHJHSESA-N
[2H]C([2H])(C1=CC=CC=C1)C(=O)O