Perdeuterobenzene is a deuterated form of benzene in which all hydrogen atoms are replaced by deuterium. It is primarily used as a solvent and reference standard in NMR spectroscopy due to its non-interfering deuterium signal and high isotopic purity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1076-43-3
Methyl 6-bromo-1H-indole-4-carboxylate
research compound
Amyloid beta 1-42
research compound for Alzheimer's disease
Dihydrocaffeic acid
Antioxidant research compound
Benzoic-d5 acid
Deuterated reference standard
Benzeneruthenium(II) chloride dimer
organometallic reagent for homogeneous catalysis
Benzene
solvent and chemical intermediate
1,2,3,4,5,6-hexadeuteriobenzene
UHOVQNZJYSORNB-MZWXYZOWSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H]