Magnesium nitrate is an inorganic compound that exists as a white solid, commonly encountered as the hexahydrate form. It is primarily significant for its use as a catalyst and in pyrotechnic compositions due to its oxidizing properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 10377-60-3
SODIUM NITRATE
Explosives, fertilizers, photographic processing
질산 칼륨
Pesticide active ingredient
Europium Nitrate Hexahydrate
rare earth metal intermediate
Bismuth nitrate pentahydrate
synthesis of other bismuth compounds
Palladium nitrate
Catalyst for chemical reactions
Zinc nitrate hexahydrate
Mordant in dyeing
Ethylenediaminetetraacetic acid tetrasodium salt dihydrate
chelating agent
Tri-p-tolylphosphine
Ligand for transition metal catalysis
magnesium dinitrate
YIXJRHPUWRPCBB-UHFFFAOYSA-N
[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mg+2]