Magnesium nitrate is an inorganic compound that exists as a white solid, commonly encountered as the hexahydrate form. It is primarily significant for its use as a catalyst and in pyrotechnic compositions due to its oxidizing properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
통제 물질
이 목록의 물질은 화학무기 또는 전구물질 규정에 따라 엄격히 통제됩니다. ChemAbout는 이러한 물질의 조달을 중개하지 않으며, 이 페이지는 규정 준수 참고용입니다.
CAS 10377-60-3
SODIUM NITRATE
Explosives, fertilizers, photographic processing
질산 칼륨
Pesticide active ingredient
Europium Nitrate Hexahydrate
rare earth metal intermediate
Bismuth nitrate pentahydrate
synthesis of other bismuth compounds
Palladium nitrate
Catalyst for chemical reactions
Zinc nitrate hexahydrate
Mordant in dyeing
Ethylenediaminetetraacetic acid tetrasodium salt dihydrate
chelating agent
Tri-p-tolylphosphine
Ligand for transition metal catalysis
MAGNESIUM NITRATE(CAS 10377-60-3)의 국제 HS 코드는 2834.29입니다.
2834.29
2834 29 80
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
magnesium dinitrate
YIXJRHPUWRPCBB-UHFFFAOYSA-N
[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mg+2]