Tri-p-tolylphosphine is an organophosphorus compound commonly employed as a ligand in transition metal catalysis. Its structure features three p-tolyl groups attached to a central phosphorus atom, contributing to its utility in coordination chemistry and cross-coupling reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Tri-p-tolylphosphine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3,5-Dichloro-4-fluorobenzonitrile
chemical intermediate for agrochemicals and pharmaceuticals
4-Butylaniline
liquid crystal intermediate
파라 톨루엔 술폰산
Acid catalyst for chemical synthesis
1,4-Dibutoxybenzene
chemical intermediate for dyes and pigments
tris(4-methylphenyl)phosphane
WXAZIUYTQHYBFW-UHFFFAOYSA-N
CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C
Tri-p-tolylphosphine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.