This compound is a pharmaceutical intermediate featuring a chiral center, an aromatic ring, and a chlorinated ketone moiety. It is primarily used as a building block in the synthesis of peptide-related compounds and other pharmaceutical agents.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-(cyclopropylcarbonyl)piperazine hydrochloride
pharmaceutical intermediate
2-Fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzonitrile
pharmaceutical intermediate
(2R)-N-(2-Benzoyl-4-chlorophenyl)-1-(phenylmethyl)-2-pyrrolidinecarboxamide Hydrochloride
Pharmaceutical intermediate for diazepam impurity
Boc-Arg(Mtr)-OH
protected arginine derivative for peptide synthesis
tert-butyl N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]carbamate
JAKDNFBATYIEIE-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)CCl
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.