Boc-Arg(Mtr)-OH is a protected arginine derivative used as a building block in solid-phase peptide synthesis. Its significance lies in the orthogonal protection strategy provided by the Boc group on the alpha-amino function and the Mtr group on the guanidino side chain, enabling selective deprotection during peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Boc-Arg(Mtr)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N5-[[[(2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-ornithine
protected arginine derivative for peptide synthesis
N5-[[[(2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-L-ornithine
protected arginine derivative for peptide synthesis
N-Boc-cis-4-hydroxy-L-proline methyl ester
Peptide synthesis building block
1-tert-butyl 2-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate
Boc-protected amino acid intermediate
2-Methylamino-5-chlorobenzophenone
Pharmaceutical intermediate for benzodiazepine synthesis
(3S)-3-methylmorpholine hydrochloride
pharmaceutical intermediate
(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid
CXZHJRGYWGPJSD-HNNXBMFYSA-N
CC1=CC(=C(C(=C1S(=O)(=O)NC(=NCCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C)N)C)C)OC
Boc-Arg(Mtr)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.