5-Chloro-2-methoxyphenylboronic acid is a boronic acid compound used as a research reagent. It contains an aromatic ring, an ether group, and a halogen atom, and is commonly employed in organic synthesis for the preparation of more complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 89694-48-4
(3-Phenylnaphthalen-1-yl)boronic acid
Boronic acid research compound
(3-phenylphenyl)boronic Acid
Boronic acid research compound
1-Naphthaleneboronic acid
Boronic acid research compound
3,5-Dimethylisoxazole-4-boronic acid
Boronic acid research compound
4-Bromo-3-nitro-1H-pyrazole
research compound
2-Isopropylbenzeneboronic acid
research compound
5-(Ethylthio)-1H-tetrazole
Oligonucleotide synthesis activator
1-(chloromethyl)-3-(trifluoromethoxy)benzene
research compound
(5-chloro-2-methoxyphenyl)boronic acid
FMBVAOHFMSQDGT-UHFFFAOYSA-N
B(C1=C(C=CC(=C1)Cl)OC)(O)O
—