1-Naphthaleneboronic acid is a boronic acid derivative used primarily as a research compound. It features two aromatic rings and is commonly employed in organic synthesis and materials science investigations.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13922-41-3
(6-hydroxynaphthalen-2-yl)boronic Acid
Boronic acid research compound
(3-Phenylnaphthalen-1-yl)boronic acid
Boronic acid research compound
3,5-Dimethylisoxazole-4-boronic acid
Boronic acid research compound
(3-phenylphenyl)boronic Acid
Boronic acid research compound
(+/-)-Ropivacaine-d7 (propyl-d7)
deuterated analytical standard
1-Ethyl-5-iodopyrazole
Research compound
Internalized-arginylglycylaspartic acid cyclic peptide
research compound
4-(Trifluoromethoxy)phenylboronic acid
research compound for organic synthesis
naphthalen-1-ylboronic acid
HUMMCEUVDBVXTQ-UHFFFAOYSA-N
B(C1=CC=CC2=CC=CC=C12)(O)O