4-(Trifluoromethoxy)phenylboronic acid is a boronic acid derivative frequently employed as a research compound in organic synthesis. Its structure features an aromatic ring with a trifluoromethoxy substituent, contributing to its reactivity and utility in building complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 139301-27-2
4-Nitrophenylboronic acid
research compound for organic synthesis
2,3,4,5-Tetrafluorobenzoic acid
research compound for organic synthesis
4-(Trifluoromethyl)phenylboronic acid
research compound for organic synthesis
3-FORMYL-4-(TRIFLUOROMETHOXY)PHENYBORONIC ACID
research compound for organic synthesis
Tetraamminepalladium(II) chloride monohydrate
research compound for palladium chemistry
Azido-PEG2-PFP ester
bioconjugation crosslinking reagent
4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,5-dioxo-1-pyrrolidinyl ester
PEG-linked alkyne NHS ester crosslinker
(5-Chloro-3-(trifluoromethyl)pyridin-2-yl)methanamine
research reagent
[4-(trifluoromethoxy)phenyl]boronic acid
HUOFUOCSQCYFPW-UHFFFAOYSA-N
B(C1=CC=C(C=C1)OC(F)(F)F)(O)O
—