Methyl 2-acetamido-2-(dimethoxyphosphoryl)acetate is a research reagent identified by the code Ac-D-Gly(PO(OMe)2)-OMe. It is a phosphorylated amino acid derivative commonly used as a laboratory compound in chemical synthesis and biochemical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 89524-99-2
4-Chloropyrido[4,3-d]pyrimidine
Research reagent
5-Chloro-2-methoxyphenylboronic acid
Boronic acid research compound
4-Bromo-3-nitro-1H-pyrazole
research compound
2-Isopropylbenzeneboronic acid
research compound
methyl 2-acetamido-2-dimethoxyphosphorylacetate
MXNIODZSMNMILW-UHFFFAOYSA-N
CC(=O)NC(C(=O)OC)P(=O)(OC)OC