This compound is a boronic acid derivative used as a pharmaceutical intermediate. It contains a pyridine ring and a tert-butyloxycarbonyl (Boc) protected amine group, making it suitable for use in organic synthesis and medicinal chemistry research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 883231-20-7
2-Bromo-4,5-difluorophenylacetic acid
Pharmaceutical intermediate for synthesis
Tert-Butyl (1,4'-bipiperidin-4-ylmethyl)-carbamate
Pharmaceutical intermediate for drug synthesis
3-(2-(Benzylamino)ethyl)quinazoline-2,4(1H,3H)-dione
pharmaceutical intermediate compound
2,4,5-Trifluorobenzoyl chloride
Pharmaceutical intermediate synthesis
[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]boronic acid
KAFAFKANQAGBRH-UHFFFAOYSA-N
B(C1=CN=C(C=C1)NC(=O)OC(C)(C)C)(O)O
—