2-Bromo-4,5-difluorophenylacetic acid is a chemical compound used as a pharmaceutical intermediate. It features a bromine and two fluorine substituents on an aromatic ring, along with a carboxylic acid group, contributing to its utility in medicinal chemistry synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 883502-07-6
Tert-Butyl (1,4'-bipiperidin-4-ylmethyl)-carbamate
Pharmaceutical intermediate for drug synthesis
3-(2-(Benzylamino)ethyl)quinazoline-2,4(1H,3H)-dione
pharmaceutical intermediate compound
2,4,5-Trifluorobenzoyl chloride
Pharmaceutical intermediate synthesis
5-chloro-6-methoxypyridine-3-carboxylic acid
Pharmaceutical intermediate
2-(2-bromo-4,5-difluorophenyl)acetic acid
FQSLXVRCDYUESO-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)F)Br)CC(=O)O
—