Diethyl 2,3-difluorofumarate is a fluorinated organic compound used as a building block in chemical synthesis. It features two ester groups and two fluorine atoms on a carbon backbone, making it valuable for introducing fluorine into target molecules in research and industrial chemistry.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 7589-41-5
4-(Ethoxycarbonyl)-4,4-difluorobutanoic acid
fluorinated building block for synthesis
(2Z)-2,3-Difluoro-2-butenedioic acid
fluorinated building block for synthesis
Ethyl 2-fluoro-3-oxopentanoate
research compound
1-Ethyl-1-nitrosourea
experimental mutagen and ethylating agent
2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Vinyl boronate synthetic reagent
Phthalic Acid Anhydride-d4
Reference standard for analytical chemistry
Diethyl 2,3-difluoromaleate
research compound
diethyl (E)-2,3-difluorobut-2-enedioate
PBYMHUNMKVHXHO-AATRIKPKSA-N
CCOC(=O)/C(=C(/C(=O)OCC)\F)/F