1,10-Decanedioic-d16 acid is a deuterated analytical reference standard, chemically a hexadecadeuterio-labeled form of decanedioic acid. It is primarily used in research and laboratory settings as a stable isotope-labeled compound for analytical method development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 73351-71-0
Nonanedioic-D14 Acid
deuterated analytical reference standard
1,14-TETRADECANEDIOIC-D24 ACID
stable isotope labeled research compound
Hexadecanedioic acid-d28
deuterated reference standard
1,8-OCTANEDIOIC-D12 ACID
deuterated analytical reference standard
Tert-Butylamine borane
Borane reducing agent complex
3-Bromobenzothiophene
Research compound for chemical synthesis
Trans-2,3-Dimethoxycinnamic acid
research compound
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecadeuteriodecanedioic acid
CXMXRPHRNRROMY-SADLKCKLSA-N
[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O