trans-2,3-Dimethoxycinnamic acid is a research compound that features a cinnamic acid backbone with two methoxy substituents on the aromatic ring. It is primarily used as a laboratory reagent in chemical and pharmaceutical research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 7345-82-6
3-(Cyclohexylamino)-2-hydroxy-1-propanesulfonic acid
biological buffer reagent
Rhodium(II) Octanoate Dimer
research compound
1,2,3,4,5,6,7-heptadeuterioindole
Deuterated indole for research use
(S)-butane-1,2-diol
research compound
(E)-3-(2,3-dimethoxyphenyl)prop-2-enoic acid
QAXPUWGAGVERSJ-VOTSOKGWSA-N
COC1=CC=CC(=C1OC)/C=C/C(=O)O