3,5-Bis(trifluoromethyl)benzoic acid is a chemical compound featuring a benzoic acid core substituted with two trifluoromethyl groups at the 3 and 5 positions. It is primarily used as an intermediate in the synthesis of pharmaceutical compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 725-89-3
3-Fluoro-5-(trifluoromethyl)benzoic acid
research compound
2-Bromo-1,1-dimethoxyethane
Bromoacetaldehyde dimethyl acetal intermediate
6-Methoxypyridazin-3-amine
Pharmaceutical intermediate
2'-Oxo Ifosfamide
Pharmaceutical intermediate for ifosfamide analogs
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
3,5-bis(trifluoromethyl)benzoic acid
HVFQJWGYVXKLTE-UHFFFAOYSA-N
C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)O