3-Fluoro-5-(trifluoromethyl)benzoic acid is a research compound primarily used in laboratory and manufacturing settings. It is a structurally distinct molecule from flufenamic acid, which is an anthranilic acid derivative and NSAID, but the two share certain structural features.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 161622-05-5
3,5-Bis(trifluoromethyl)benzoic acid
Pharmaceutical intermediate synthesis
4-Bromo-3-(trifluoromethyl)benzoic acid
research compound
(S)-1-BENZYL-PYRROLIDINE-3-CARBOXYLIC ACID
Research chemical
1,3-Dibromobenzene-d4
Deuterated research compound
3,4-Difluorohydrocinnamic acid
research compound
3-fluoro-5-(trifluoromethyl)benzoic acid
NSGKIIGVPBTOBF-UHFFFAOYSA-N
C1=C(C=C(C=C1C(F)(F)F)F)C(=O)O
—