4-(piperazin-1-yl)benzonitrile is a research compound featuring a piperazine ring linked to a benzonitrile moiety. It is primarily used as a laboratory reagent for chemical and pharmaceutical research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 68104-63-2
(3,3-difluorocyclobutyl)methanol
research compound
(2R,4S)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid
research compound
2,2'-Bipyridine-4,4'-dicarboxylic acid
research compound for coordination chemistry
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
4-piperazin-1-ylbenzonitrile
DJJNYEXRPRQXPD-UHFFFAOYSA-N
C1CN(CCN1)C2=CC=C(C=C2)C#N