N-Boc-L-tert-Leucine is an amino acid derivative used as a building block in peptide synthesis. It features a tert-butyloxycarbonyl (Boc) protecting group, which is commonly employed to shield the amino group during solid-phase or solution-phase peptide assembly.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 62965-35-9
Fmoc-His(Boc)-OH
amino acid derivative for peptide synthesis
Methyl 4-oxocyclohexanecarboxylate
Pharmaceutical intermediate
4-Pyridineethanethiol Hydrochloride
Pharmaceutical intermediate
Methyl 2,4-dichloropyrimidine-6-carboxylate
Pharmaceutical intermediate
Androstenedione
steroid hormone intermediate
(2R)-2-{[(tert-butoxy)carbonyl]amino}-3,3-dimethylbutanoic acid
Protected amino acid for peptide synthesis
(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
LRFZIPCTFBPFLX-SSDOTTSWSA-N
CC(C)(C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C