This compound is a protected amino acid derivative, specifically a tert-butoxycarbonyl (Boc)-protected form of D-tert-butylglycine. It is primarily used as a building block in peptide synthesis, where the protecting groups facilitate controlled formation of peptide bonds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 124655-17-0
3-methylazetidin-3-ol Hydrochloride
pharmaceutical intermediate
(1S,4R)-4-(2-Amino-6-chloro-9H-purin-9-yl)-2-cyclopentene-1-carboxylate
Impurity of abacavir synthesis
2-(4-ethylphenyl)-2-methylpropanoic acid
Pharmaceutical intermediate
5-(4'-(Bromomethyl)(1,1'-biphenyl)-2-yl)-1-trityl-1h-tetraazole
pharmaceutical intermediate
N-Boc-L-tert-Leucine
amino acid derivative for peptide synthesis
(2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
LRFZIPCTFBPFLX-ZETCQYMHSA-N
CC(C)(C)[C@H](C(=O)O)NC(=O)OC(C)(C)C