5-Acetamido-2-aminobenzoic acid is a chemical compound used as a pharmaceutical intermediate. It features an aromatic ring with an amino group and a carboxylic acid group, and is commonly employed in the synthesis of active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 50670-83-2
L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-(phenylmethyl)-
Protected amino acid for peptide synthesis
Z-TYR(TBU)-OME
Protected amino acid intermediate
Bis(4-nitrophenyl) carbonate
pharmaceutical intermediate
6-Isopropylchromone-3-carbonitrile
pharmaceutical intermediate
5-acetamido-2-aminobenzoic acid
GSOHXJQXAKNJES-UHFFFAOYSA-N
CC(=O)NC1=CC(=C(C=C1)N)C(=O)O